C14H15N3OS — CID 137216961
(2S)-2-[(2S)-butan-2-yl]-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-3-one (PubChem CID 137216961) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is (2S)-2-[(2S)-butan-2-yl]-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-3-one.
| Compound Name | (2S)-2-[(2S)-butan-2-yl]-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-3-one |
|---|---|
| PubChem CID | 137216961 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (2S)-2-[(2S)-butan-2-yl]-5-sulfanylidene-1,2-dihydroimidazo[1,2-c]quinazolin-3-one |
| SMILES | CC[C@H](C)[C@@H]1Nc2c3ccccc3nc(=S)n2C1=O |
| InChI | InChI=1S/C14H15N3OS/c1-3-8(2)11-13(18)17-12(16-11)9-6-4-5-7-10(9)15-14(17)19/h4-8,11,16H,3H2,1-2H3/t8-,11-/m0/s1 |
| InChIKey | MOTQNLQDCNDDNA-KWQFWETISA-N |
| XLogP | 3.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|