C9H7N3O4 — CID 137218916
2-[2-(hydroxyamino)-4-pyridinyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 137218916) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 2-[2-(hydroxyamino)-4-pyridinyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[2-(hydroxyamino)-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137218916 |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-[2-(hydroxyamino)-4-pyridinyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-c2ccnc(NO)c2)n1 |
| InChI | InChI=1S/C9H7N3O4/c13-9(14)6-4-16-8(11-6)5-1-2-10-7(3-5)12-15/h1-4,15H,(H,10,12)(H,13,14) |
| InChIKey | VVJICAAZYOORGM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|