C14H23N3O2S — CID 137222001
4,5-diethyl-2-(2-morpholin-4-ylethylsulfanyl)-1H-pyrimidin-6-one (PubChem CID 137222001) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4,5-diethyl-2-(2-morpholin-4-ylethylsulfanyl)-1H-pyrimidin-6-one.
| Compound Name | 4,5-diethyl-2-(2-morpholin-4-ylethylsulfanyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137222001 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4,5-diethyl-2-(2-morpholin-4-ylethylsulfanyl)-1H-pyrimidin-6-one |
| SMILES | CCc1nc(SCCN2CCOCC2)[nH]c(=O)c1CC |
| InChI | InChI=1S/C14H23N3O2S/c1-3-11-12(4-2)15-14(16-13(11)18)20-10-7-17-5-8-19-9-6-17/h3-10H2,1-2H3,(H,15,16,18) |
| InChIKey | BVQMBPYEYUJAMH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |