C15H23N3O3S — CID 42739040
6-ethyl-3-methyl-2-(4-morpholin-4-yl-4-oxobutyl)sulfanylpyrimidin-4-one (PubChem CID 42739040) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 6-ethyl-3-methyl-2-(4-morpholin-4-yl-4-oxobutyl)sulfanylpyrimidin-4-one.
| Compound Name | 6-ethyl-3-methyl-2-(4-morpholin-4-yl-4-oxobutyl)sulfanylpyrimidin-4-one |
|---|---|
| PubChem CID | 42739040 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 6-ethyl-3-methyl-2-(4-morpholin-4-yl-4-oxobutyl)sulfanylpyrimidin-4-one |
| SMILES | CCc1cc(=O)n(C)c(SCCCC(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C15H23N3O3S/c1-3-12-11-14(20)17(2)15(16-12)22-10-4-5-13(19)18-6-8-21-9-7-18/h11H,3-10H2,1-2H3 |
| InChIKey | CWDKWNZSJFMBHF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|