C20H15N5O2 — CID 137222571
2-[4-amino-3-(phenyliminomethyl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137222571) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[4-amino-3-(phenyliminomethyl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-amino-3-(phenyliminomethyl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137222571 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-amino-3-(phenyliminomethyl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | Nc1ccc(Oc2nc3cnccc3c(=O)[nH]2)cc1/C=N/c1ccccc1 |
| InChI | InChI=1S/C20H15N5O2/c21-17-7-6-15(10-13(17)11-23-14-4-2-1-3-5-14)27-20-24-18-12-22-9-8-16(18)19(26)25-20/h1-12H,21H2,(H,24,25,26)/b23-11+ |
| InChIKey | FYVTZOIDKKFXQR-FOKLQQMPSA-N |
| XLogP | 3.44 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|