C21H17N3O3 — CID 145046641
2-[4-[(3-methoxyphenyl)methyl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 145046641) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-[4-[(3-methoxyphenyl)methyl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-[(3-methoxyphenyl)methyl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145046641 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[4-[(3-methoxyphenyl)methyl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1cccc(Cc2ccc(Oc3nc4cnccc4c(=O)[nH]3)cc2)c1 |
| InChI | InChI=1S/C21H17N3O3/c1-26-17-4-2-3-15(12-17)11-14-5-7-16(8-6-14)27-21-23-19-13-22-10-9-18(19)20(25)24-21/h2-10,12-13H,11H2,1H3,(H,23,24,25) |
| InChIKey | GQVUQVCQNAVBKV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |