C25H23N3O3 — CID 166924455
2-[4-[2-(3-methoxyphenyl)-3-methylbut-3-en-2-yl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 166924455) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-[4-[2-(3-methoxyphenyl)-3-methylbut-3-en-2-yl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-[2-(3-methoxyphenyl)-3-methylbut-3-en-2-yl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166924455 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[4-[2-(3-methoxyphenyl)-3-methylbut-3-en-2-yl]phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | C=C(C)C(C)(c1ccc(Oc2nc3cnccc3c(=O)[nH]2)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C25H23N3O3/c1-16(2)25(3,18-6-5-7-20(14-18)30-4)17-8-10-19(11-9-17)31-24-27-22-15-26-13-12-21(22)23(29)28-24/h5-15H,1H2,2-4H3,(H,27,28,29) |
| InChIKey | QAPQSNDAUOXCLJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|