C23H25ClN6O5 — CID 137223060
tert-butyl 4-chloro-2-[[8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate (PubChem CID 137223060) has the molecular formula C23H25ClN6O5 and a molecular weight of 500.94 g/mol. Its IUPAC name is tert-butyl 4-chloro-2-[[8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-chloro-2-[[8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 137223060 |
| Molecular Formula | C23H25ClN6O5 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | tert-butyl 4-chloro-2-[[8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3,7-dimethyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
| SMILES | C/C(=N\O)c1nc2c(c(=O)n(Cc3cc4c(Cl)cccc4n3C(=O)OC(C)(C)C)c(=O)n2C)n1C |
| InChI | InChI=1S/C23H25ClN6O5/c1-12(26-34)18-25-19-17(27(18)5)20(31)29(21(32)28(19)6)11-13-10-14-15(24)8-7-9-16(14)30(13)22(33)35-23(2,3)4/h7-10,34H,11H2,1-6H3/b26-12+ |
| InChIKey | FJOIERJKYGKPIL-RPPGKUMJSA-N |
| XLogP | 3.07 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|