C24H27ClN6O5 — CID 137223250
tert-butyl 4-chloro-2-[[3-ethyl-8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-7-methyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate (PubChem CID 137223250) has the molecular formula C24H27ClN6O5 and a molecular weight of 514.97 g/mol. Its IUPAC name is tert-butyl 4-chloro-2-[[3-ethyl-8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-7-methyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-chloro-2-[[3-ethyl-8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-7-methyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 137223250 |
| Molecular Formula | C24H27ClN6O5 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | tert-butyl 4-chloro-2-[[3-ethyl-8-[(E)-N-hydroxy-C-methylcarbonimidoyl]-7-methyl-2,6-dioxopurin-1-yl]methyl]indole-1-carboxylate |
| SMILES | CCn1c(=O)n(Cc2cc3c(Cl)cccc3n2C(=O)OC(C)(C)C)c(=O)c2c1nc(/C(C)=N/O)n2C |
| InChI | InChI=1S/C24H27ClN6O5/c1-7-29-20-18(28(6)19(26-20)13(2)27-35)21(32)30(22(29)33)12-14-11-15-16(25)9-8-10-17(15)31(14)23(34)36-24(3,4)5/h8-11,35H,7,12H2,1-6H3/b27-13+ |
| InChIKey | CMRKKWAPCNAQLJ-UVHMKAGCSA-N |
| XLogP | 3.55 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|