C26H30N8O7S — CID 137227510
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(1-methoxy-1-oxo-3-prop-2-enylsulfanylpropan-2-yl)amino]-5-oxopentanoic acid (PubChem CID 137227510) has the molecular formula C26H30N8O7S and a molecular weight of 598.64 g/mol. Its IUPAC name is 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(1-methoxy-1-oxo-3-prop-2-enylsulfanylpropan-2-yl)amino]-5-oxopentanoic acid.
| Compound Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(1-methoxy-1-oxo-3-prop-2-enylsulfanylpropan-2-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 137227510 |
| Molecular Formula | C26H30N8O7S |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]-5-[(1-methoxy-1-oxo-3-prop-2-enylsulfanylpropan-2-yl)amino]-5-oxopentanoic acid |
| SMILES | C=CCSCC(NC(=O)CCC(NC(=O)c1ccc(NCc2cnc3nc(N)[nH]c(=O)c3n2)cc1)C(=O)O)C(=O)OC |
| InChI | InChI=1S/C26H30N8O7S/c1-3-10-42-13-18(25(40)41-2)31-19(35)9-8-17(24(38)39)32-22(36)14-4-6-15(7-5-14)28-11-16-12-29-21-20(30-16)23(37)34-26(27)33-21/h3-7,12,17-18,28H,1,8-11,13H2,2H3,(H,31,35)(H,32,36)(H,38,39)(H3,27,29,33,34,37) |
| InChIKey | JZWJBSXKUNVDFE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 231.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|