C68H53N3 — CID 137227622
N-[(benzylamino)-[4-[4-[4-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]naphthalen-1-yl]phenyl]methyl]-4-phenylbenzenecarboximidamide (PubChem CID 137227622) has the molecular formula C68H53N3 and a molecular weight of 912.19 g/mol. Its IUPAC name is N-[(benzylamino)-[4-[4-[4-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]naphthalen-1-yl]phenyl]methyl]-4-phenylbenzenecarboximidamide.
| Compound Name | N-[(benzylamino)-[4-[4-[4-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]naphthalen-1-yl]phenyl]methyl]-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 137227622 |
| Molecular Formula | C68H53N3 |
| Molecular Weight | 912.19 g/mol |
| Exact Mass | 911.42 |
| IUPAC Name | N-[(benzylamino)-[4-[4-[4-[4-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]naphthalen-1-yl]phenyl]methyl]-4-phenylbenzenecarboximidamide |
| SMILES | [H]/N=C(/NC(NCc1ccccc1)c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)c4ccccc34)c3ccccc23)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C68H53N3/c1-68(2)64-24-14-13-23-62(64)63-38-37-53(43-65(63)68)48-25-29-49(30-26-48)54-39-41-60(58-21-11-9-19-56(54)58)61-42-40-55(57-20-10-12-22-59(57)61)50-31-35-52(36-32-50)67(70-44-45-15-5-3-6-16-45)71-66(69)51-33-27-47(28-34-51)46-17-7-4-8-18-46/h3-43,67,70H,44H2,1-2H3,(H2,69,71) |
| InChIKey | UKNHDXOCBKNELV-UHFFFAOYSA-N |
| XLogP | 17.04 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.19 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|