C26H24N4O3 — CID 137227843
[2-(9-hydroxyiminofluoren-4-yl)-3H-benzimidazol-5-yl] 4-(dimethylamino)butanoate (PubChem CID 137227843) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-(9-hydroxyiminofluoren-4-yl)-3H-benzimidazol-5-yl] 4-(dimethylamino)butanoate.
| Compound Name | [2-(9-hydroxyiminofluoren-4-yl)-3H-benzimidazol-5-yl] 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 137227843 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-(9-hydroxyiminofluoren-4-yl)-3H-benzimidazol-5-yl] 4-(dimethylamino)butanoate |
| SMILES | CN(C)CCCC(=O)Oc1ccc2nc(-c3cccc4c3-c3ccccc3C4=NO)[nH]c2c1 |
| InChI | InChI=1S/C26H24N4O3/c1-30(2)14-6-11-23(31)33-16-12-13-21-22(15-16)28-26(27-21)20-10-5-9-19-24(20)17-7-3-4-8-18(17)25(19)29-32/h3-5,7-10,12-13,15,32H,6,11,14H2,1-2H3,(H,27,28) |
| InChIKey | VNEQZYJEMUVWIQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|