C29H35Cl2N9O2 — CID 138618299
N-[1-(diaminomethylideneamino)ethyl]-2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazole-5-carboxamide;dihydrochloride (PubChem CID 138618299) has the molecular formula C29H35Cl2N9O2 and a molecular weight of 612.57 g/mol. Its IUPAC name is N-[1-(diaminomethylideneamino)ethyl]-2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | N-[1-(diaminomethylideneamino)ethyl]-2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 138618299 |
| Molecular Formula | C29H35Cl2N9O2 |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | N-[1-(diaminomethylideneamino)ethyl]-2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazole-5-carboxamide;dihydrochloride |
| SMILES | CC(N=C(N)N)NC(=O)c1ccc2nc(-c3ccc(-c4nc5ccc(OCCCN(C)C)cc5[nH]4)cc3)[nH]c2c1.Cl.Cl |
| InChI | InChI=1S/C29H33N9O2.2ClH/c1-17(33-29(30)31)32-28(39)20-9-11-22-24(15-20)36-26(34-22)18-5-7-19(8-6-18)27-35-23-12-10-21(16-25(23)37-27)40-14-4-13-38(2)3;;/h5-12,15-17H,4,13-14H2,1-3H3,(H,32,39)(H,34,36)(H,35,37)(H4,30,31,33);2*1H |
| InChIKey | NHRDYNKEJOAEJO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|