C36H42N8O2 — CID 161314603
1-[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]-4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-one (PubChem CID 161314603) has the molecular formula C36H42N8O2 and a molecular weight of 618.79 g/mol. Its IUPAC name is 1-[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]-4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-one.
| Compound Name | 1-[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]-4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 161314603 |
| Molecular Formula | C36H42N8O2 |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | 1-[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]-4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-one |
| SMILES | CN(C)CCCOc1ccc2nc(-c3ccc(-c4nc5ccc(C(=O)CCCN6CCCN7CCCN=C76)cc5[nH]4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C36H42N8O2/c1-42(2)17-6-22-46-28-13-15-30-32(24-28)41-35(39-30)26-10-8-25(9-11-26)34-38-29-14-12-27(23-31(29)40-34)33(45)7-3-18-43-20-5-21-44-19-4-16-37-36(43)44/h8-15,23-24H,3-7,16-22H2,1-2H3,(H,38,40)(H,39,41) |
| InChIKey | VJIIESNMZYMDHT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|