C35H40N6O3 — CID 138649466
4-[[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]oxy]-N-hex-5-ynylbutanamide (PubChem CID 138649466) has the molecular formula C35H40N6O3 and a molecular weight of 592.74 g/mol. Its IUPAC name is 4-[[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]oxy]-N-hex-5-ynylbutanamide.
| Compound Name | 4-[[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]oxy]-N-hex-5-ynylbutanamide |
|---|---|
| PubChem CID | 138649466 |
| Molecular Formula | C35H40N6O3 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 4-[[2-[4-[6-[3-(dimethylamino)propoxy]-1H-benzimidazol-2-yl]phenyl]-3H-benzimidazol-5-yl]oxy]-N-hex-5-ynylbutanamide |
| SMILES | C#CCCCCNC(=O)CCCOc1ccc2nc(-c3ccc(-c4nc5ccc(OCCCN(C)C)cc5[nH]4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C35H40N6O3/c1-4-5-6-7-19-36-33(42)10-8-21-43-27-15-17-29-31(23-27)39-34(37-29)25-11-13-26(14-12-25)35-38-30-18-16-28(24-32(30)40-35)44-22-9-20-41(2)3/h1,11-18,23-24H,5-10,19-22H2,2-3H3,(H,36,42)(H,37,39)(H,38,40) |
| InChIKey | NRGKMLHYOJGJOA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|