C16H14N4O3S — CID 137228000
12-(3,4-dihydroxyphenyl)-4-propan-2-yl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one (PubChem CID 137228000) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 12-(3,4-dihydroxyphenyl)-4-propan-2-yl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one.
| Compound Name | 12-(3,4-dihydroxyphenyl)-4-propan-2-yl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 137228000 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 12-(3,4-dihydroxyphenyl)-4-propan-2-yl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8,11-tetraen-2-one |
| SMILES | CC(C)c1csc2nc3[nH]nc(-c4ccc(O)c(O)c4)n3c(=O)c12 |
| InChI | InChI=1S/C16H14N4O3S/c1-7(2)9-6-24-14-12(9)15(23)20-13(18-19-16(20)17-14)8-3-4-10(21)11(22)5-8/h3-7,21-22H,1-2H3,(H,17,19) |
| InChIKey | WZVLHKFBXBNHAI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|