C21H16FN3O4S — CID 137228796
2-[2-[[4-[3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 137228796) has the molecular formula C21H16FN3O4S and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[2-[[4-[3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 137228796 |
| Molecular Formula | C21H16FN3O4S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-[2-[[4-[3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc(C=CC(=O)c3ccc(F)cc3)cc2)NC1=O |
| InChI | InChI=1S/C21H16FN3O4S/c22-16-8-6-15(7-9-16)17(26)10-5-13-1-3-14(4-2-13)12-23-25-21-24-20(29)18(30-21)11-19(27)28/h1-10,12,18H,11H2,(H,27,28)(H,24,25,29) |
| InChIKey | GQTBOMJBNKHZFM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|