C20H22N4O5 — CID 137231638
N-[(2S,3R)-1-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 137231638) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[(2S,3R)-1-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3R)-1-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 137231638 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[(2S,3R)-1-[2-[(2-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1ccccc1)C(=O)NN=Cc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C20H22N4O5/c1-3-13(2)18(22-19(26)14-7-5-4-6-8-14)20(27)23-21-12-15-11-16(24(28)29)9-10-17(15)25/h4-13,18,25H,3H2,1-2H3,(H,22,26)(H,23,27)/t13-,18+/m1/s1 |
| InChIKey | ZQOFIJVYJWVGFD-ACJLOTCBSA-N |
| XLogP | 2.60 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|