C26H23ClN4O4S — CID 137236217
(6R)-3-[(4-chlorophenyl)methylsulfanyl]-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137236217) has the molecular formula C26H23ClN4O4S and a molecular weight of 523.01 g/mol. Its IUPAC name is (6R)-3-[(4-chlorophenyl)methylsulfanyl]-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-3-[(4-chlorophenyl)methylsulfanyl]-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137236217 |
| Molecular Formula | C26H23ClN4O4S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | (6R)-3-[(4-chlorophenyl)methylsulfanyl]-6-(2,4,6-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | COc1cc(OC)c([C@@H]2N=c3ccccc3=C3C(=O)NC(SCc4ccc(Cl)cc4)=NN32)c(OC)c1 |
| InChI | InChI=1S/C26H23ClN4O4S/c1-33-17-12-20(34-2)22(21(13-17)35-3)24-28-19-7-5-4-6-18(19)23-25(32)29-26(30-31(23)24)36-14-15-8-10-16(27)11-9-15/h4-13,24H,14H2,1-3H3,(H,29,30,32)/t24-/m1/s1 |
| InChIKey | CBWZWSOEHPHNIM-XMMPIXPASA-N |
| XLogP | 3.44 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |