C22H22N4O2S — CID 137237158
(6R)-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237158) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is (6R)-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6R)-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237158 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (6R)-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCSC1=NN2C(=c3ccccc3=N[C@H]2c2ccc(OCC)c(C)c2)C(=O)N1 |
| InChI | InChI=1S/C22H22N4O2S/c1-4-12-29-22-24-21(27)19-16-8-6-7-9-17(16)23-20(26(19)25-22)15-10-11-18(28-5-2)14(3)13-15/h4,6-11,13,20H,1,5,12H2,2-3H3,(H,24,25,27)/t20-/m1/s1 |
| InChIKey | NVYWNTAYNKTKTF-HXUWFJFHSA-N |
| XLogP | 2.46 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|