C18H29NO5S — CID 137241605
2-[(E)-N-[(E)-but-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 137241605) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-[(E)-N-[(E)-but-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(E)-N-[(E)-but-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 137241605 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[(E)-N-[(E)-but-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfonylpropyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | C/C=C/CO/N=C(\CC)C1=C(O)CC(CC(C)S(=O)(=O)CC)CC1=O |
| InChI | InChI=1S/C18H29NO5S/c1-5-8-9-24-19-15(6-2)18-16(20)11-14(12-17(18)21)10-13(4)25(22,23)7-3/h5,8,13-14,20H,6-7,9-12H2,1-4H3/b8-5+,19-15+ |
| InChIKey | TWFQTZWTDXECOO-ILAMNELRSA-N |
| XLogP | 3.35 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|