C18H29NO3S — CID 135783412
5-[(2R)-2-ethylsulfanylpropyl]-3-hydroxy-2-[(E)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-2-en-1-one (PubChem CID 135783412) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is 5-[(2R)-2-ethylsulfanylpropyl]-3-hydroxy-2-[(E)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-2-en-1-one.
| Compound Name | 5-[(2R)-2-ethylsulfanylpropyl]-3-hydroxy-2-[(E)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135783412 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 5-[(2R)-2-ethylsulfanylpropyl]-3-hydroxy-2-[(E)-N-prop-2-enoxy-C-propylcarbonimidoyl]cyclohex-2-en-1-one |
| SMILES | C=CCO/N=C(\CCC)C1=C(O)CC(C[C@@H](C)SCC)CC1=O |
| InChI | InChI=1S/C18H29NO3S/c1-5-8-15(19-22-9-6-2)18-16(20)11-14(12-17(18)21)10-13(4)23-7-3/h6,13-14,20H,2,5,7-12H2,1,3-4H3/b19-15+/t13-,14?/m1/s1 |
| InChIKey | YSYBMOYYJRRHIG-OXEBKDJESA-N |
| XLogP | 4.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|