C27H49NO3S — CID 174476049
dec-1-ene;2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 174476049) has the molecular formula C27H49NO3S and a molecular weight of 467.76 g/mol. Its IUPAC name is dec-1-ene;2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | dec-1-ene;2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 174476049 |
| Molecular Formula | C27H49NO3S |
| Molecular Weight | 467.76 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | dec-1-ene;2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | C=CCCCCCCCC.CCCC(=NOCC)C1=C(O)CC(CC(C)SCC)CC1=O |
| InChI | InChI=1S/C17H29NO3S.C10H20/c1-5-8-14(18-21-6-2)17-15(19)10-13(11-16(17)20)9-12(4)22-7-3;1-3-5-7-9-10-8-6-4-2/h12-13,19H,5-11H2,1-4H3;3H,1,4-10H2,2H3 |
| InChIKey | AADRINQVEGHIOT-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.76 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|