C21H37NO4S2 — CID 173422914
2-[N-(1-ethoxyethoxy)-C-propylcarbonimidoyl]-5-[2-(1-ethylsulfanylethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 173422914) has the molecular formula C21H37NO4S2 and a molecular weight of 431.66 g/mol. Its IUPAC name is 2-[N-(1-ethoxyethoxy)-C-propylcarbonimidoyl]-5-[2-(1-ethylsulfanylethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[N-(1-ethoxyethoxy)-C-propylcarbonimidoyl]-5-[2-(1-ethylsulfanylethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 173422914 |
| Molecular Formula | C21H37NO4S2 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 2-[N-(1-ethoxyethoxy)-C-propylcarbonimidoyl]-5-[2-(1-ethylsulfanylethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCCC(=NOC(C)OCC)C1=C(O)CC(CC(C)SC(C)SCC)CC1=O |
| InChI | InChI=1S/C21H37NO4S2/c1-7-10-18(22-26-15(5)25-8-2)21-19(23)12-17(13-20(21)24)11-14(4)28-16(6)27-9-3/h14-17,23H,7-13H2,1-6H3 |
| InChIKey | ZSTBLNHUOBWVTK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|