C9H7N3O — CID 137241662
N-(1,7-naphthyridin-2-ylmethylidene)hydroxylamine (PubChem CID 137241662) has the molecular formula C9H7N3O and a molecular weight of 173.18 g/mol. Its IUPAC name is N-(1,7-naphthyridin-2-ylmethylidene)hydroxylamine.
| Compound Name | N-(1,7-naphthyridin-2-ylmethylidene)hydroxylamine |
|---|---|
| PubChem CID | 137241662 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | N-(1,7-naphthyridin-2-ylmethylidene)hydroxylamine |
| SMILES | ON=Cc1ccc2ccncc2n1 |
| InChI | InChI=1S/C9H7N3O/c13-11-5-8-2-1-7-3-4-10-6-9(7)12-8/h1-6,13H |
| InChIKey | MMMQUUKDDWSHRB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|