C32H22F2N8O4Zn — CID 137242158
bis(N-[(E)-(6-fluoro-2-hydroxyquinolin-3-yl)methylideneamino]pyridine-3-carboxamide);zinc (PubChem CID 137242158) has the molecular formula C32H22F2N8O4Zn and a molecular weight of 685.97 g/mol. Its IUPAC name is bis(N-[(E)-(6-fluoro-2-hydroxyquinolin-3-yl)methylideneamino]pyridine-3-carboxamide);zinc.
| Compound Name | bis(N-[(E)-(6-fluoro-2-hydroxyquinolin-3-yl)methylideneamino]pyridine-3-carboxamide);zinc |
|---|---|
| PubChem CID | 137242158 |
| Molecular Formula | C32H22F2N8O4Zn |
| Molecular Weight | 685.97 g/mol |
| Exact Mass | 684.10 |
| IUPAC Name | bis(N-[(E)-(6-fluoro-2-hydroxyquinolin-3-yl)methylideneamino]pyridine-3-carboxamide);zinc |
| SMILES | O=C(N/N=C/c1cc2cc(F)ccc2nc1O)c1cccnc1.O=C(N/N=C/c1cc2cc(F)ccc2nc1O)c1cccnc1.[Zn] |
| InChI | InChI=1S/2C16H11FN4O2.Zn/c2*17-13-3-4-14-11(7-13)6-12(15(22)20-14)9-19-21-16(23)10-2-1-5-18-8-10;/h2*1-9H,(H,20,22)(H,21,23);/b2*19-9+; |
| InChIKey | SIYOCOZHOKGUCH-QHQAJOGDSA-N |
| XLogP | 4.47 |
| TPSA | 174.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.97 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|