C18H27NO2 — CID 137246755
2-tert-butyl-6-[(2-hydroxycyclohexyl)iminomethyl]-4-methylphenol (PubChem CID 137246755) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-tert-butyl-6-[(2-hydroxycyclohexyl)iminomethyl]-4-methylphenol.
| Compound Name | 2-tert-butyl-6-[(2-hydroxycyclohexyl)iminomethyl]-4-methylphenol |
|---|---|
| PubChem CID | 137246755 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-tert-butyl-6-[(2-hydroxycyclohexyl)iminomethyl]-4-methylphenol |
| SMILES | Cc1cc(/C=N/C2CCCCC2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO2/c1-12-9-13(17(21)14(10-12)18(2,3)4)11-19-15-7-5-6-8-16(15)20/h9-11,15-16,20-21H,5-8H2,1-4H3/b19-11+ |
| InChIKey | NHYLWONOFBTVPJ-YBFXNURJSA-N |
| XLogP | 3.72 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|