C21H28NO2SSi — CID 137246856
CID 137246856 (PubChem CID 137246856) has the molecular formula C21H28NO2SSi and a molecular weight of 386.61 g/mol.
| Compound Name | CID 137246856 |
|---|---|
| PubChem CID | 137246856 |
| Molecular Formula | C21H28NO2SSi |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)/C(=C\N(C)S(=O)(=O)c1ccc(C)cc1)c1ccccc1C |
| InChI | InChI=1S/C21H28NO2SSi/c1-6-26(7-2)21(20-11-9-8-10-18(20)4)16-22(5)25(23,24)19-14-12-17(3)13-15-19/h8-16H,6-7H2,1-5H3/b21-16- |
| InChIKey | IIGRYTGYJBJGSL-PGMHBOJBSA-N |
| XLogP | 5.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|