C11H14N2O4 — CID 137249466
(2R)-3-(4-carbamimidoyl-3-hydroxyphenoxy)-2-methylpropanoic acid (PubChem CID 137249466) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is (2R)-3-(4-carbamimidoyl-3-hydroxyphenoxy)-2-methylpropanoic acid.
| Compound Name | (2R)-3-(4-carbamimidoyl-3-hydroxyphenoxy)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 137249466 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2R)-3-(4-carbamimidoyl-3-hydroxyphenoxy)-2-methylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC[C@@H](C)C(=O)O)cc1O |
| InChI | InChI=1S/C11H14N2O4/c1-6(11(15)16)5-17-7-2-3-8(10(12)13)9(14)4-7/h2-4,6,14H,5H2,1H3,(H3,12,13)(H,15,16)/t6-/m1/s1 |
| InChIKey | DYRYNIOLDPVPHK-ZCFIWIBFSA-N |
| XLogP | 0.78 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|