C9H18O2Si2 — CID 137252816
CID 137252816 (PubChem CID 137252816) has the molecular formula C9H18O2Si2 and a molecular weight of 214.41 g/mol.
| Compound Name | CID 137252816 |
|---|---|
| PubChem CID | 137252816 |
| Molecular Formula | C9H18O2Si2 |
| Molecular Weight | 214.41 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | — |
| SMILES | C#CCO[Si]O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H18O2Si2/c1-7-8-10-12-11-13(5,6)9(2,3)4/h1H,8H2,2-6H3 |
| InChIKey | KFOYSLITAADSLB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|