C18H34N2O2Si — CID 135019809
1-[tert-butyl(dimethyl)silyl]oxy-3-[methyl(prop-2-ynyl)amino]-2-[[methyl(prop-2-ynyl)amino]methyl]propan-2-ol (PubChem CID 135019809) has the molecular formula C18H34N2O2Si and a molecular weight of 338.57 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-[methyl(prop-2-ynyl)amino]-2-[[methyl(prop-2-ynyl)amino]methyl]propan-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-[methyl(prop-2-ynyl)amino]-2-[[methyl(prop-2-ynyl)amino]methyl]propan-2-ol |
|---|---|
| PubChem CID | 135019809 |
| Molecular Formula | C18H34N2O2Si |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-[methyl(prop-2-ynyl)amino]-2-[[methyl(prop-2-ynyl)amino]methyl]propan-2-ol |
| SMILES | C#CCN(C)CC(O)(CO[Si](C)(C)C(C)(C)C)CN(C)CC#C |
| InChI | InChI=1S/C18H34N2O2Si/c1-10-12-19(6)14-18(21,15-20(7)13-11-2)16-22-23(8,9)17(3,4)5/h1-2,21H,12-16H2,3-9H3 |
| InChIKey | KHBCIGHNIGLHKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|