C19H20N4O2S — CID 137253174
2-[4-(thiophen-2-ylmethyl)-1,4-diazepane-1-carbonyl]-3H-quinazolin-4-one (PubChem CID 137253174) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[4-(thiophen-2-ylmethyl)-1,4-diazepane-1-carbonyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-(thiophen-2-ylmethyl)-1,4-diazepane-1-carbonyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137253174 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[4-(thiophen-2-ylmethyl)-1,4-diazepane-1-carbonyl]-3H-quinazolin-4-one |
| SMILES | O=C(c1nc2ccccc2c(=O)[nH]1)N1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C19H20N4O2S/c24-18-15-6-1-2-7-16(15)20-17(21-18)19(25)23-9-4-8-22(10-11-23)13-14-5-3-12-26-14/h1-3,5-7,12H,4,8-11,13H2,(H,20,21,24) |
| InChIKey | RYTAMFXDCWEMRX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |