C22H25FN4O — CID 137253178
2-[2-[[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one (PubChem CID 137253178) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[2-[[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-[[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137253178 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[2-[[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]amino]ethyl]-3H-quinazolin-4-one |
| SMILES | Cc1cc(F)ccc1N1CCC(NCCc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H25FN4O/c1-15-14-16(23)6-7-20(15)27-12-9-17(10-13-27)24-11-8-21-25-19-5-3-2-4-18(19)22(28)26-21/h2-7,14,17,24H,8-13H2,1H3,(H,25,26,28) |
| InChIKey | JTSKUXRUVCYNOR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |