C9H8ClN3O3 — CID 137256039
3-(2-amino-5-chloro-4-methoxyphenyl)-4H-1,2,4-oxadiazol-5-one (PubChem CID 137256039) has the molecular formula C9H8ClN3O3 and a molecular weight of 241.63 g/mol. Its IUPAC name is 3-(2-amino-5-chloro-4-methoxyphenyl)-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-(2-amino-5-chloro-4-methoxyphenyl)-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137256039 |
| Molecular Formula | C9H8ClN3O3 |
| Molecular Weight | 241.63 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 3-(2-amino-5-chloro-4-methoxyphenyl)-4H-1,2,4-oxadiazol-5-one |
| SMILES | COc1cc(N)c(-c2noc(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C9H8ClN3O3/c1-15-7-3-6(11)4(2-5(7)10)8-12-9(14)16-13-8/h2-3H,11H2,1H3,(H,12,13,14) |
| InChIKey | WEKAKZGIQMRNTR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.63 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|