C16H13Cl2N3O4 — CID 146342469
3-[4-[(3,5-dichloro-2-hydroxyanilino)methyl]-2-methoxyphenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 146342469) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is 3-[4-[(3,5-dichloro-2-hydroxyanilino)methyl]-2-methoxyphenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-[(3,5-dichloro-2-hydroxyanilino)methyl]-2-methoxyphenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 146342469 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-[4-[(3,5-dichloro-2-hydroxyanilino)methyl]-2-methoxyphenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | COc1cc(CNc2cc(Cl)cc(Cl)c2O)ccc1-c1noc(=O)[nH]1 |
| InChI | InChI=1S/C16H13Cl2N3O4/c1-24-13-4-8(2-3-10(13)15-20-16(23)25-21-15)7-19-12-6-9(17)5-11(18)14(12)22/h2-6,19,22H,7H2,1H3,(H,20,21,23) |
| InChIKey | ZQVMFLDJDWJYQN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|