C20H24N4O2 — CID 137256777
(1S,10R)-5-methyl-N-[(4-methylphenyl)methyl]-7-oxo-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-diene-13-carboxamide (PubChem CID 137256777) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (1S,10R)-5-methyl-N-[(4-methylphenyl)methyl]-7-oxo-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-diene-13-carboxamide.
| Compound Name | (1S,10R)-5-methyl-N-[(4-methylphenyl)methyl]-7-oxo-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-diene-13-carboxamide |
|---|---|
| PubChem CID | 137256777 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (1S,10R)-5-methyl-N-[(4-methylphenyl)methyl]-7-oxo-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-diene-13-carboxamide |
| SMILES | Cc1ccc(CNC(=O)N2[C@@H]3CC[C@H]2Cc2nc(C)[nH]c(=O)c2C3)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-12-3-5-14(6-4-12)11-21-20(26)24-15-7-8-16(24)10-18-17(9-15)19(25)23-13(2)22-18/h3-6,15-16H,7-11H2,1-2H3,(H,21,26)(H,22,23,25)/t15-,16+/m1/s1 |
| InChIKey | KZDPDRGJICDXQZ-CVEARBPZSA-N |
| XLogP | 2.23 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |