C19H22N4O2 — CID 156610102
N-[(4-methoxyphenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 156610102) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 156610102 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2C3CCC2c2cnc(C)nc2C3)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-12-20-11-16-17(22-12)9-14-5-8-18(16)23(14)19(24)21-10-13-3-6-15(25-2)7-4-13/h3-4,6-7,11,14,18H,5,8-10H2,1-2H3,(H,21,24) |
| InChIKey | OULJSRPRMKSOEB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |