C14H26N4 — CID 137257058
2-butylimino-N-methyl-N-[3-(methylideneamino)propyl]-3,4-dihydro-1H-pyridin-4-amine (PubChem CID 137257058) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-butylimino-N-methyl-N-[3-(methylideneamino)propyl]-3,4-dihydro-1H-pyridin-4-amine.
| Compound Name | 2-butylimino-N-methyl-N-[3-(methylideneamino)propyl]-3,4-dihydro-1H-pyridin-4-amine |
|---|---|
| PubChem CID | 137257058 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 2-butylimino-N-methyl-N-[3-(methylideneamino)propyl]-3,4-dihydro-1H-pyridin-4-amine |
| SMILES | C=NCCCN(C)C1C=CN/C(=N/CCCC)C1 |
| InChI | InChI=1S/C14H26N4/c1-4-5-9-16-14-12-13(7-10-17-14)18(3)11-6-8-15-2/h7,10,13H,2,4-6,8-9,11-12H2,1,3H3,(H,16,17) |
| InChIKey | ISLVMXOJRGHYCN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|