C19H38N4 — CID 142031740
N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide;ethane (PubChem CID 142031740) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide;ethane.
| Compound Name | N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide;ethane |
|---|---|
| PubChem CID | 142031740 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide;ethane |
| SMILES | C/C=C/N=C(/CC1=NCCC(CC)N1)N/C=C/CC.CC.CC |
| InChI | InChI=1S/C15H26N4.2C2H6/c1-4-7-10-17-14(16-9-5-2)12-15-18-11-8-13(6-3)19-15;2*1-2/h5,7,9-10,13H,4,6,8,11-12H2,1-3H3,(H,16,17)(H,18,19);2*1-2H3/b9-5+,10-7+;; |
| InChIKey | WLVXAEMFRCXHOX-SILBLGSPSA-N |
| XLogP | 5.04 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|