C15H26N4 — CID 142031741
N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide (PubChem CID 142031741) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide.
| Compound Name | N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide |
|---|---|
| PubChem CID | 142031741 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-[(E)-but-1-enyl]-2-(6-ethyl-1,4,5,6-tetrahydropyrimidin-2-yl)-N'-[(E)-prop-1-enyl]ethanimidamide |
| SMILES | C/C=C/N=C(/CC1=NCCC(CC)N1)N/C=C/CC |
| InChI | InChI=1S/C15H26N4/c1-4-7-10-17-14(16-9-5-2)12-15-18-11-8-13(6-3)19-15/h5,7,9-10,13H,4,6,8,11-12H2,1-3H3,(H,16,17)(H,18,19)/b9-5+,10-7+ |
| InChIKey | QDYLQOVEHAWICM-FWMCCXIMSA-N |
| XLogP | 2.99 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|