C20H26N4O — CID 137257490
4,5-dimethyl-2-[6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]-1H-pyrimidin-6-one (PubChem CID 137257490) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 4,5-dimethyl-2-[6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]-1H-pyrimidin-6-one.
| Compound Name | 4,5-dimethyl-2-[6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137257490 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4,5-dimethyl-2-[6-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-3-pyridinyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(-c2ccc(N3CC(C)C4CCCCC43)nc2)[nH]c(=O)c1C |
| InChI | InChI=1S/C20H26N4O/c1-12-11-24(17-7-5-4-6-16(12)17)18-9-8-15(10-21-18)19-22-14(3)13(2)20(25)23-19/h8-10,12,16-17H,4-7,11H2,1-3H3,(H,22,23,25) |
| InChIKey | JQTCQQPKYCQONA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |