C22H24N2O3 — CID 137259731
N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2-ethoxybenzamide (PubChem CID 137259731) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2-ethoxybenzamide.
| Compound Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 137259731 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(4-tert-butyl-2-oxo-1,4a-dihydroquinolin-7-ylidene)-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)/N=C1\C=CC2C(=C1)NC(=O)C=C2C(C)(C)C |
| InChI | InChI=1S/C22H24N2O3/c1-5-27-19-9-7-6-8-16(19)21(26)23-14-10-11-15-17(22(2,3)4)13-20(25)24-18(15)12-14/h6-13,15H,5H2,1-4H3,(H,24,25)/b23-14+ |
| InChIKey | JBRAYRUWJOFRTF-OEAKJJBVSA-N |
| XLogP | 3.84 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|