C12H17N3O2 — CID 137261926
1-ethyl-3-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]urea (PubChem CID 137261926) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]urea.
| Compound Name | 1-ethyl-3-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 137261926 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 1-ethyl-3-[(E)-(4-hydroxy-3,5-dimethylphenyl)methylideneamino]urea |
| SMILES | CCNC(=O)N/N=C/c1cc(C)c(O)c(C)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-4-13-12(17)15-14-7-10-5-8(2)11(16)9(3)6-10/h5-7,16H,4H2,1-3H3,(H2,13,15,17)/b14-7+ |
| InChIKey | PLNALVCVTZCPAO-VGOFMYFVSA-N |
| XLogP | 1.66 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|