C8H10N2O2 — CID 137262486
5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one (PubChem CID 137262486) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one.
| Compound Name | 5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137262486 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one |
| SMILES | CC1(C)OCc2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C8H10N2O2/c1-8(2)6-5(3-12-8)9-4-10-7(6)11/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | LEHCHURDVVQJGS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |