C10H14N2O2 — CID 137272882
2-ethyl-5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one (PubChem CID 137272882) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-ethyl-5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one.
| Compound Name | 2-ethyl-5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137272882 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-ethyl-5,5-dimethyl-3,7-dihydrofuro[3,4-d]pyrimidin-4-one |
| SMILES | CCc1nc2c(c(=O)[nH]1)C(C)(C)OC2 |
| InChI | InChI=1S/C10H14N2O2/c1-4-7-11-6-5-14-10(2,3)8(6)9(13)12-7/h4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | KLRPJLOVDWWKSM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |