C9H10N2O3 — CID 141461929
2,7,7-trimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461929) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2,7,7-trimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 2,7,7-trimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461929 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2,7,7-trimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
| SMILES | Cc1nc2c(c(=O)[nH]1)C(=O)OC2(C)C |
| InChI | InChI=1S/C9H10N2O3/c1-4-10-6-5(7(12)11-4)8(13)14-9(6,2)3/h1-3H3,(H,10,11,12) |
| InChIKey | LMIYTWOPMRWHEJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |