C12H16N2O3 — CID 141461941
2-tert-butyl-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461941) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-tert-butyl-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 2-tert-butyl-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461941 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-tert-butyl-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
| SMILES | CC(C)(C)c1nc2c(c(=O)[nH]1)C(=O)OC2(C)C |
| InChI | InChI=1S/C12H16N2O3/c1-11(2,3)10-13-7-6(8(15)14-10)9(16)17-12(7,4)5/h1-5H3,(H,13,14,15) |
| InChIKey | KAPPKDJZVNSXKD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |