C9H10N2O4 — CID 141461945
2-methoxy-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461945) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-methoxy-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 2-methoxy-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461945 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-methoxy-7,7-dimethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
| SMILES | COc1nc2c(c(=O)[nH]1)C(=O)OC2(C)C |
| InChI | InChI=1S/C9H10N2O4/c1-9(2)5-4(7(13)15-9)6(12)11-8(10-5)14-3/h1-3H3,(H,10,11,12) |
| InChIKey | DOARKMJQNCWVHX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |