C14H20N2O3 — CID 141461942
2-tert-butyl-7,7-diethyl-3H-furo[3,4-d]pyrimidine-4,5-dione (PubChem CID 141461942) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-tert-butyl-7,7-diethyl-3H-furo[3,4-d]pyrimidine-4,5-dione.
| Compound Name | 2-tert-butyl-7,7-diethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 141461942 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-tert-butyl-7,7-diethyl-3H-furo[3,4-d]pyrimidine-4,5-dione |
| SMILES | CCC1(CC)OC(=O)c2c1nc(C(C)(C)C)[nH]c2=O |
| InChI | InChI=1S/C14H20N2O3/c1-6-14(7-2)9-8(11(18)19-14)10(17)16-12(15-9)13(3,4)5/h6-7H2,1-5H3,(H,15,16,17) |
| InChIKey | BFBICSAFBASANL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |