C9H12N2O2 — CID 172576459
2,7,7-trimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one (PubChem CID 172576459) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,7,7-trimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one.
| Compound Name | 2,7,7-trimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 172576459 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2,7,7-trimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)COC2(C)C |
| InChI | InChI=1S/C9H12N2O2/c1-5-10-7-6(8(12)11-5)4-13-9(7,2)3/h4H2,1-3H3,(H,10,11,12) |
| InChIKey | MHOCSAXGLDIABH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |